C8H11N9O2 — CID 83215607
2-[[4-amino-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]amino]ethyl carbamate (PubChem CID 83215607) has the molecular formula C8H11N9O2 and a molecular weight of 265.24 g/mol. Its IUPAC name is 2-[[4-amino-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]amino]ethyl carbamate.
| Compound Name | 2-[[4-amino-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]amino]ethyl carbamate |
|---|---|
| PubChem CID | 83215607 |
| Molecular Formula | C8H11N9O2 |
| Molecular Weight | 265.24 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 2-[[4-amino-6-(1,2,4-triazol-1-yl)-1,3,5-triazin-2-yl]amino]ethyl carbamate |
| SMILES | NC(=O)OCCNc1nc(N)nc(-n2cncn2)n1 |
| InChI | InChI=1S/C8H11N9O2/c9-5-14-7(12-1-2-19-6(10)18)16-8(15-5)17-4-11-3-13-17/h3-4H,1-2H2,(H2,10,18)(H3,9,12,14,15,16) |
| InChIKey | OPQOKQVQEAWEPN-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 159.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.24 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|