About 3-(4,7-difluoro-2,3-dioxoindol-1-yl)-N-ethylpropanamide
3-(4,7-difluoro-2,3-dioxoindol-1-yl)-N-ethylpropanamide (PubChem CID 83215709) has the molecular formula C13H12F2N2O3
and a molecular weight of 282.25 g/mol. Its IUPAC name is 3-(4,7-difluoro-2,3-dioxoindol-1-yl)-N-ethylpropanamide.
Molecular Properties
| Compound Name | 3-(4,7-difluoro-2,3-dioxoindol-1-yl)-N-ethylpropanamide |
| PubChem CID | 83215709 |
| Molecular Formula | C13H12F2N2O3 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 3-(4,7-difluoro-2,3-dioxoindol-1-yl)-N-ethylpropanamide |
| SMILES | CCNC(=O)CCN1C(=O)C(=O)c2c(F)ccc(F)c21 |
| InChI | InChI=1S/C13H12F2N2O3/c1-2-16-9(18)5-6-17-11-8(15)4-3-7(14)10(11)12(19)13(17)20/h3-4H,2,5-6H2,1H3,(H,16,18) |
| InChIKey | DUVZSQPWONZXBW-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(4,7-difluoro-2,3-dioxoindol-1-yl)-N-ethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,7-difluoro-2,3-dioxoindol-1-yl)-N-ethylpropanamide?
The IUPAC name of 3-(4,7-difluoro-2,3-dioxoindol-1-yl)-N-ethylpropanamide (CID 83215709) is 3-(4,7-difluoro-2,3-dioxoindol-1-yl)-N-ethylpropanamide.
What is the SMILES notation for 3-(4,7-difluoro-2,3-dioxoindol-1-yl)-N-ethylpropanamide?
The canonical SMILES for 3-(4,7-difluoro-2,3-dioxoindol-1-yl)-N-ethylpropanamide is CCNC(=O)CCN1C(=O)C(=O)c2c(F)ccc(F)c21.
What is the InChIKey of 3-(4,7-difluoro-2,3-dioxoindol-1-yl)-N-ethylpropanamide?
The InChIKey is DUVZSQPWONZXBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F2N2O3/c1-2-16-9(18)5-6-17-11-8(15)4-3-7(14)10(11)12(19)13(17)20/h3-4H,2,5-6H2,1H3,(H,16,18).
What are the key properties of 3-(4,7-difluoro-2,3-dioxoindol-1-yl)-N-ethylpropanamide?
3-(4,7-difluoro-2,3-dioxoindol-1-yl)-N-ethylpropanamide has a molecular weight of 282.25 g/mol, XLogP of 1.02, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,7-difluoro-2,3-dioxoindol-1-yl)-N-ethylpropanamide is sourced from PubChem (CID 83215709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).