C11H21NO — CID 83217860
3-propan-2-yl-2,3,5,5a,6,7,8,8a-octahydro-1H-cyclopenta[e][1,4]oxazepine (PubChem CID 83217860) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is 3-propan-2-yl-2,3,5,5a,6,7,8,8a-octahydro-1H-cyclopenta[e][1,4]oxazepine.
| Compound Name | 3-propan-2-yl-2,3,5,5a,6,7,8,8a-octahydro-1H-cyclopenta[e][1,4]oxazepine |
|---|---|
| PubChem CID | 83217860 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 3-propan-2-yl-2,3,5,5a,6,7,8,8a-octahydro-1H-cyclopenta[e][1,4]oxazepine |
| SMILES | CC(C)C1CNC2CCCC2CO1 |
| InChI | InChI=1S/C11H21NO/c1-8(2)11-6-12-10-5-3-4-9(10)7-13-11/h8-12H,3-7H2,1-2H3 |
| InChIKey | LUSHSLVKXJTRBD-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |