C14H22N2 — CID 83217968
1,8,8-trimethyl-2,3,4,6,7,9-hexahydro-1H-pyrido[1,2-a]benzimidazole (PubChem CID 83217968) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 1,8,8-trimethyl-2,3,4,6,7,9-hexahydro-1H-pyrido[1,2-a]benzimidazole.
| Compound Name | 1,8,8-trimethyl-2,3,4,6,7,9-hexahydro-1H-pyrido[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 83217968 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 1,8,8-trimethyl-2,3,4,6,7,9-hexahydro-1H-pyrido[1,2-a]benzimidazole |
| SMILES | CC1CCCc2nc3c(n21)CC(C)(C)CC3 |
| InChI | InChI=1S/C14H22N2/c1-10-5-4-6-13-15-11-7-8-14(2,3)9-12(11)16(10)13/h10H,4-9H2,1-3H3 |
| InChIKey | FJBHYCWGWGWMTF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |