About 2-methyl-5-thiophen-2-yl-1,4-oxazepane
2-methyl-5-thiophen-2-yl-1,4-oxazepane (PubChem CID 83218118) has the molecular formula C10H15NOS
and a molecular weight of 197.30 g/mol. Its IUPAC name is 2-methyl-5-thiophen-2-yl-1,4-oxazepane.
Molecular Properties
| Compound Name | 2-methyl-5-thiophen-2-yl-1,4-oxazepane |
| PubChem CID | 83218118 |
| Molecular Formula | C10H15NOS |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | 2-methyl-5-thiophen-2-yl-1,4-oxazepane |
| SMILES | CC1CNC(c2cccs2)CCO1 |
| InChI | InChI=1S/C10H15NOS/c1-8-7-11-9(4-5-12-8)10-3-2-6-13-10/h2-3,6,8-9,11H,4-5,7H2,1H3 |
| InChIKey | JNONBASXQZPEIF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-5-thiophen-2-yl-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-thiophen-2-yl-1,4-oxazepane?
The IUPAC name of 2-methyl-5-thiophen-2-yl-1,4-oxazepane (CID 83218118) is 2-methyl-5-thiophen-2-yl-1,4-oxazepane.
What is the SMILES notation for 2-methyl-5-thiophen-2-yl-1,4-oxazepane?
The canonical SMILES for 2-methyl-5-thiophen-2-yl-1,4-oxazepane is CC1CNC(c2cccs2)CCO1.
What is the InChIKey of 2-methyl-5-thiophen-2-yl-1,4-oxazepane?
The InChIKey is JNONBASXQZPEIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NOS/c1-8-7-11-9(4-5-12-8)10-3-2-6-13-10/h2-3,6,8-9,11H,4-5,7H2,1H3.
What are the key properties of 2-methyl-5-thiophen-2-yl-1,4-oxazepane?
2-methyl-5-thiophen-2-yl-1,4-oxazepane has a molecular weight of 197.30 g/mol, XLogP of 2.19, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-thiophen-2-yl-1,4-oxazepane is sourced from PubChem (CID 83218118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).