C13H18F2N2 — CID 83218583
4-(2-ethyl-5-methylpyrrolidin-1-yl)-3,5-difluoroaniline (PubChem CID 83218583) has the molecular formula C13H18F2N2 and a molecular weight of 240.30 g/mol. Its IUPAC name is 4-(2-ethyl-5-methylpyrrolidin-1-yl)-3,5-difluoroaniline.
| Compound Name | 4-(2-ethyl-5-methylpyrrolidin-1-yl)-3,5-difluoroaniline |
|---|---|
| PubChem CID | 83218583 |
| Molecular Formula | C13H18F2N2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 4-(2-ethyl-5-methylpyrrolidin-1-yl)-3,5-difluoroaniline |
| SMILES | CCC1CCC(C)N1c1c(F)cc(N)cc1F |
| InChI | InChI=1S/C13H18F2N2/c1-3-10-5-4-8(2)17(10)13-11(14)6-9(16)7-12(13)15/h6-8,10H,3-5,16H2,1-2H3 |
| InChIKey | SDPKIIOLNHDIGB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|