About 2-ethyl-5-methyl-N'-propan-2-ylpyrrolidine-1-carboximidamide
2-ethyl-5-methyl-N'-propan-2-ylpyrrolidine-1-carboximidamide (PubChem CID 83219210) has the molecular formula C11H23N3
and a molecular weight of 197.33 g/mol. Its IUPAC name is 2-ethyl-5-methyl-N'-propan-2-ylpyrrolidine-1-carboximidamide.
Molecular Properties
| Compound Name | 2-ethyl-5-methyl-N'-propan-2-ylpyrrolidine-1-carboximidamide |
| PubChem CID | 83219210 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | 2-ethyl-5-methyl-N'-propan-2-ylpyrrolidine-1-carboximidamide |
| SMILES | CCC1CCC(C)N1/C(N)=N/C(C)C |
| InChI | InChI=1S/C11H23N3/c1-5-10-7-6-9(4)14(10)11(12)13-8(2)3/h8-10H,5-7H2,1-4H3,(H2,12,13) |
| InChIKey | KPNFGVDHNHLJQQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-5-methyl-N'-propan-2-ylpyrrolidine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-5-methyl-N'-propan-2-ylpyrrolidine-1-carboximidamide?
The IUPAC name of 2-ethyl-5-methyl-N'-propan-2-ylpyrrolidine-1-carboximidamide (CID 83219210) is 2-ethyl-5-methyl-N'-propan-2-ylpyrrolidine-1-carboximidamide.
What is the SMILES notation for 2-ethyl-5-methyl-N'-propan-2-ylpyrrolidine-1-carboximidamide?
The canonical SMILES for 2-ethyl-5-methyl-N'-propan-2-ylpyrrolidine-1-carboximidamide is CCC1CCC(C)N1/C(N)=N/C(C)C.
What is the InChIKey of 2-ethyl-5-methyl-N'-propan-2-ylpyrrolidine-1-carboximidamide?
The InChIKey is KPNFGVDHNHLJQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3/c1-5-10-7-6-9(4)14(10)11(12)13-8(2)3/h8-10H,5-7H2,1-4H3,(H2,12,13).
What are the key properties of 2-ethyl-5-methyl-N'-propan-2-ylpyrrolidine-1-carboximidamide?
2-ethyl-5-methyl-N'-propan-2-ylpyrrolidine-1-carboximidamide has a molecular weight of 197.33 g/mol, XLogP of 1.97, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-5-methyl-N'-propan-2-ylpyrrolidine-1-carboximidamide is sourced from PubChem (CID 83219210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).