About 3-(chloromethyl)-2-(2-ethyl-5-methylpyrrolidin-1-yl)-4,6-dimethylpyridine
3-(chloromethyl)-2-(2-ethyl-5-methylpyrrolidin-1-yl)-4,6-dimethylpyridine (PubChem CID 83220560) has the molecular formula C15H23ClN2
and a molecular weight of 266.82 g/mol. Its IUPAC name is 3-(chloromethyl)-2-(2-ethyl-5-methylpyrrolidin-1-yl)-4,6-dimethylpyridine.
Molecular Properties
| Compound Name | 3-(chloromethyl)-2-(2-ethyl-5-methylpyrrolidin-1-yl)-4,6-dimethylpyridine |
| PubChem CID | 83220560 |
| Molecular Formula | C15H23ClN2 |
| Molecular Weight | 266.82 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 3-(chloromethyl)-2-(2-ethyl-5-methylpyrrolidin-1-yl)-4,6-dimethylpyridine |
| SMILES | CCC1CCC(C)N1c1nc(C)cc(C)c1CCl |
| InChI | InChI=1S/C15H23ClN2/c1-5-13-7-6-12(4)18(13)15-14(9-16)10(2)8-11(3)17-15/h8,12-13H,5-7,9H2,1-4H3 |
| InChIKey | RYAXFEIIYRPXEJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.82 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(chloromethyl)-2-(2-ethyl-5-methylpyrrolidin-1-yl)-4,6-dimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(chloromethyl)-2-(2-ethyl-5-methylpyrrolidin-1-yl)-4,6-dimethylpyridine?
The IUPAC name of 3-(chloromethyl)-2-(2-ethyl-5-methylpyrrolidin-1-yl)-4,6-dimethylpyridine (CID 83220560) is 3-(chloromethyl)-2-(2-ethyl-5-methylpyrrolidin-1-yl)-4,6-dimethylpyridine.
What is the SMILES notation for 3-(chloromethyl)-2-(2-ethyl-5-methylpyrrolidin-1-yl)-4,6-dimethylpyridine?
The canonical SMILES for 3-(chloromethyl)-2-(2-ethyl-5-methylpyrrolidin-1-yl)-4,6-dimethylpyridine is CCC1CCC(C)N1c1nc(C)cc(C)c1CCl.
What is the InChIKey of 3-(chloromethyl)-2-(2-ethyl-5-methylpyrrolidin-1-yl)-4,6-dimethylpyridine?
The InChIKey is RYAXFEIIYRPXEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23ClN2/c1-5-13-7-6-12(4)18(13)15-14(9-16)10(2)8-11(3)17-15/h8,12-13H,5-7,9H2,1-4H3.
What are the key properties of 3-(chloromethyl)-2-(2-ethyl-5-methylpyrrolidin-1-yl)-4,6-dimethylpyridine?
3-(chloromethyl)-2-(2-ethyl-5-methylpyrrolidin-1-yl)-4,6-dimethylpyridine has a molecular weight of 266.82 g/mol, XLogP of 4.20, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(chloromethyl)-2-(2-ethyl-5-methylpyrrolidin-1-yl)-4,6-dimethylpyridine is sourced from PubChem (CID 83220560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).