C12H17N5 — CID 83222881
1-(3-methylbutyl)-3-pyrazin-2-ylpyrazol-4-amine (PubChem CID 83222881) has the molecular formula C12H17N5 and a molecular weight of 231.30 g/mol. Its IUPAC name is 1-(3-methylbutyl)-3-pyrazin-2-ylpyrazol-4-amine.
| Compound Name | 1-(3-methylbutyl)-3-pyrazin-2-ylpyrazol-4-amine |
|---|---|
| PubChem CID | 83222881 |
| Molecular Formula | C12H17N5 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 1-(3-methylbutyl)-3-pyrazin-2-ylpyrazol-4-amine |
| SMILES | CC(C)CCn1cc(N)c(-c2cnccn2)n1 |
| InChI | InChI=1S/C12H17N5/c1-9(2)3-6-17-8-10(13)12(16-17)11-7-14-4-5-15-11/h4-5,7-9H,3,6,13H2,1-2H3 |
| InChIKey | BGUWVIXAXPKJBE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |