1-(2-hydroxyethoxy)-3,3,5-trimethylcyclohexane-1-carboxylic acid

C12H22O4 — CID 83224896

IUPAC1-(2-hydroxyethoxy)-3,3,5-trimethylcyclohexane-1-carboxylic acid
SMILESCC1CC(C)(C)CC(OCCO)(C(=O)O)C1
InChIInChI=1S/C12H22O4/c1-9-6-11(2,3)8-12(7-9,10(14)15)16-5-4-13/h9,13H,4-8H2,1-3H3,(H,14,15)
InChIKeyMEQPJLRJZHDIIT-UHFFFAOYSA-N
MW230.30 g/mol
LogP1.66
Rot. Bonds4

About 1-(2-hydroxyethoxy)-3,3,5-trimethylcyclohexane-1-carboxylic acid

1-(2-hydroxyethoxy)-3,3,5-trimethylcyclohexane-1-carboxylic acid (PubChem CID 83224896) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is 1-(2-hydroxyethoxy)-3,3,5-trimethylcyclohexane-1-carboxylic acid.

Molecular Properties

Compound Name1-(2-hydroxyethoxy)-3,3,5-trimethylcyclohexane-1-carboxylic acid
PubChem CID83224896
Molecular FormulaC12H22O4
Molecular Weight230.30 g/mol
Exact Mass230.15
IUPAC Name1-(2-hydroxyethoxy)-3,3,5-trimethylcyclohexane-1-carboxylic acid
SMILESCC1CC(C)(C)CC(OCCO)(C(=O)O)C1
InChIInChI=1S/C12H22O4/c1-9-6-11(2,3)8-12(7-9,10(14)15)16-5-4-13/h9,13H,4-8H2,1-3H3,(H,14,15)
InChIKeyMEQPJLRJZHDIIT-UHFFFAOYSA-N
XLogP1.66
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.30
LogP ≤ 51.66
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 1-(2-hydroxyethoxy)-3,3,5-trimethylcyclohexane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(2-hydroxyethoxy)-3,3,5-trimethylcyclohexane-1-carboxylic acid?
The IUPAC name of 1-(2-hydroxyethoxy)-3,3,5-trimethylcyclohexane-1-carboxylic acid (CID 83224896) is 1-(2-hydroxyethoxy)-3,3,5-trimethylcyclohexane-1-carboxylic acid.
What is the SMILES notation for 1-(2-hydroxyethoxy)-3,3,5-trimethylcyclohexane-1-carboxylic acid?
The canonical SMILES for 1-(2-hydroxyethoxy)-3,3,5-trimethylcyclohexane-1-carboxylic acid is CC1CC(C)(C)CC(OCCO)(C(=O)O)C1.
What is the InChIKey of 1-(2-hydroxyethoxy)-3,3,5-trimethylcyclohexane-1-carboxylic acid?
The InChIKey is MEQPJLRJZHDIIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O4/c1-9-6-11(2,3)8-12(7-9,10(14)15)16-5-4-13/h9,13H,4-8H2,1-3H3,(H,14,15).
What are the key properties of 1-(2-hydroxyethoxy)-3,3,5-trimethylcyclohexane-1-carboxylic acid?
1-(2-hydroxyethoxy)-3,3,5-trimethylcyclohexane-1-carboxylic acid has a molecular weight of 230.30 g/mol, XLogP of 1.66, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-hydroxyethoxy)-3,3,5-trimethylcyclohexane-1-carboxylic acid is sourced from PubChem (CID 83224896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).