About 1-(1-methoxy-4,4-dimethylcyclohexyl)ethanone
1-(1-methoxy-4,4-dimethylcyclohexyl)ethanone (PubChem CID 83226150) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is 1-(1-methoxy-4,4-dimethylcyclohexyl)ethanone.
Molecular Properties
| Compound Name | 1-(1-methoxy-4,4-dimethylcyclohexyl)ethanone |
| PubChem CID | 83226150 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 1-(1-methoxy-4,4-dimethylcyclohexyl)ethanone |
| SMILES | COC1(C(C)=O)CCC(C)(C)CC1 |
| InChI | InChI=1S/C11H20O2/c1-9(12)11(13-4)7-5-10(2,3)6-8-11/h5-8H2,1-4H3 |
| InChIKey | FFQZEHFMUXIPOF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1-methoxy-4,4-dimethylcyclohexyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-methoxy-4,4-dimethylcyclohexyl)ethanone?
The IUPAC name of 1-(1-methoxy-4,4-dimethylcyclohexyl)ethanone (CID 83226150) is 1-(1-methoxy-4,4-dimethylcyclohexyl)ethanone.
What is the SMILES notation for 1-(1-methoxy-4,4-dimethylcyclohexyl)ethanone?
The canonical SMILES for 1-(1-methoxy-4,4-dimethylcyclohexyl)ethanone is COC1(C(C)=O)CCC(C)(C)CC1.
What is the InChIKey of 1-(1-methoxy-4,4-dimethylcyclohexyl)ethanone?
The InChIKey is FFQZEHFMUXIPOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2/c1-9(12)11(13-4)7-5-10(2,3)6-8-11/h5-8H2,1-4H3.
What are the key properties of 1-(1-methoxy-4,4-dimethylcyclohexyl)ethanone?
1-(1-methoxy-4,4-dimethylcyclohexyl)ethanone has a molecular weight of 184.28 g/mol, XLogP of 2.56, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-methoxy-4,4-dimethylcyclohexyl)ethanone is sourced from PubChem (CID 83226150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).