C16H24N2OS — CID 83227479
2-[2-(2-ethyl-5-methylpyrrolidin-1-yl)ethoxy]benzenecarbothioamide (PubChem CID 83227479) has the molecular formula C16H24N2OS and a molecular weight of 292.45 g/mol. Its IUPAC name is 2-[2-(2-ethyl-5-methylpyrrolidin-1-yl)ethoxy]benzenecarbothioamide.
| Compound Name | 2-[2-(2-ethyl-5-methylpyrrolidin-1-yl)ethoxy]benzenecarbothioamide |
|---|---|
| PubChem CID | 83227479 |
| Molecular Formula | C16H24N2OS |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 2-[2-(2-ethyl-5-methylpyrrolidin-1-yl)ethoxy]benzenecarbothioamide |
| SMILES | CCC1CCC(C)N1CCOc1ccccc1C(N)=S |
| InChI | InChI=1S/C16H24N2OS/c1-3-13-9-8-12(2)18(13)10-11-19-15-7-5-4-6-14(15)16(17)20/h4-7,12-13H,3,8-11H2,1-2H3,(H2,17,20) |
| InChIKey | BDKPWOREZYFERJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|