About 1-(4-amino-3,5-dimethylpyrazol-1-yl)-3-(2-ethyl-5-methylpyrrolidin-1-yl)propan-2-ol
1-(4-amino-3,5-dimethylpyrazol-1-yl)-3-(2-ethyl-5-methylpyrrolidin-1-yl)propan-2-ol (PubChem CID 83228217) has the molecular formula C15H28N4O
and a molecular weight of 280.42 g/mol. Its IUPAC name is 1-(4-amino-3,5-dimethylpyrazol-1-yl)-3-(2-ethyl-5-methylpyrrolidin-1-yl)propan-2-ol.
Molecular Properties
| Compound Name | 1-(4-amino-3,5-dimethylpyrazol-1-yl)-3-(2-ethyl-5-methylpyrrolidin-1-yl)propan-2-ol |
| PubChem CID | 83228217 |
| Molecular Formula | C15H28N4O |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.23 |
| IUPAC Name | 1-(4-amino-3,5-dimethylpyrazol-1-yl)-3-(2-ethyl-5-methylpyrrolidin-1-yl)propan-2-ol |
| SMILES | CCC1CCC(C)N1CC(O)Cn1nc(C)c(N)c1C |
| InChI | InChI=1S/C15H28N4O/c1-5-13-7-6-10(2)18(13)8-14(20)9-19-12(4)15(16)11(3)17-19/h10,13-14,20H,5-9,16H2,1-4H3 |
| InChIKey | QKGGSOWVVXTFTK-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(4-amino-3,5-dimethylpyrazol-1-yl)-3-(2-ethyl-5-methylpyrrolidin-1-yl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-amino-3,5-dimethylpyrazol-1-yl)-3-(2-ethyl-5-methylpyrrolidin-1-yl)propan-2-ol?
The IUPAC name of 1-(4-amino-3,5-dimethylpyrazol-1-yl)-3-(2-ethyl-5-methylpyrrolidin-1-yl)propan-2-ol (CID 83228217) is 1-(4-amino-3,5-dimethylpyrazol-1-yl)-3-(2-ethyl-5-methylpyrrolidin-1-yl)propan-2-ol.
What is the SMILES notation for 1-(4-amino-3,5-dimethylpyrazol-1-yl)-3-(2-ethyl-5-methylpyrrolidin-1-yl)propan-2-ol?
The canonical SMILES for 1-(4-amino-3,5-dimethylpyrazol-1-yl)-3-(2-ethyl-5-methylpyrrolidin-1-yl)propan-2-ol is CCC1CCC(C)N1CC(O)Cn1nc(C)c(N)c1C.
What is the InChIKey of 1-(4-amino-3,5-dimethylpyrazol-1-yl)-3-(2-ethyl-5-methylpyrrolidin-1-yl)propan-2-ol?
The InChIKey is QKGGSOWVVXTFTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N4O/c1-5-13-7-6-10(2)18(13)8-14(20)9-19-12(4)15(16)11(3)17-19/h10,13-14,20H,5-9,16H2,1-4H3.
What are the key properties of 1-(4-amino-3,5-dimethylpyrazol-1-yl)-3-(2-ethyl-5-methylpyrrolidin-1-yl)propan-2-ol?
1-(4-amino-3,5-dimethylpyrazol-1-yl)-3-(2-ethyl-5-methylpyrrolidin-1-yl)propan-2-ol has a molecular weight of 280.42 g/mol, XLogP of 1.71, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-amino-3,5-dimethylpyrazol-1-yl)-3-(2-ethyl-5-methylpyrrolidin-1-yl)propan-2-ol is sourced from PubChem (CID 83228217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).