About N-cyclopentyloxy-1,1-dimethoxypropan-2-amine
N-cyclopentyloxy-1,1-dimethoxypropan-2-amine (PubChem CID 83228340) has the molecular formula C10H21NO3
and a molecular weight of 203.28 g/mol. Its IUPAC name is N-cyclopentyloxy-1,1-dimethoxypropan-2-amine.
Molecular Properties
| Compound Name | N-cyclopentyloxy-1,1-dimethoxypropan-2-amine |
| PubChem CID | 83228340 |
| Molecular Formula | C10H21NO3 |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | N-cyclopentyloxy-1,1-dimethoxypropan-2-amine |
| SMILES | COC(OC)C(C)NOC1CCCC1 |
| InChI | InChI=1S/C10H21NO3/c1-8(10(12-2)13-3)11-14-9-6-4-5-7-9/h8-11H,4-7H2,1-3H3 |
| InChIKey | MRVWTEXKJCWVQB-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopentyloxy-1,1-dimethoxypropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyloxy-1,1-dimethoxypropan-2-amine?
The IUPAC name of N-cyclopentyloxy-1,1-dimethoxypropan-2-amine (CID 83228340) is N-cyclopentyloxy-1,1-dimethoxypropan-2-amine.
What is the SMILES notation for N-cyclopentyloxy-1,1-dimethoxypropan-2-amine?
The canonical SMILES for N-cyclopentyloxy-1,1-dimethoxypropan-2-amine is COC(OC)C(C)NOC1CCCC1.
What is the InChIKey of N-cyclopentyloxy-1,1-dimethoxypropan-2-amine?
The InChIKey is MRVWTEXKJCWVQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO3/c1-8(10(12-2)13-3)11-14-9-6-4-5-7-9/h8-11H,4-7H2,1-3H3.
What are the key properties of N-cyclopentyloxy-1,1-dimethoxypropan-2-amine?
N-cyclopentyloxy-1,1-dimethoxypropan-2-amine has a molecular weight of 203.28 g/mol, XLogP of 1.46, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyloxy-1,1-dimethoxypropan-2-amine is sourced from PubChem (CID 83228340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).