C17H25NO — CID 83228556
N-cyclopentyloxy-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanamine (PubChem CID 83228556) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is N-cyclopentyloxy-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanamine.
| Compound Name | N-cyclopentyloxy-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanamine |
|---|---|
| PubChem CID | 83228556 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | N-cyclopentyloxy-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanamine |
| SMILES | CC(NOC1CCCC1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C17H25NO/c1-13(18-19-17-8-4-5-9-17)15-11-10-14-6-2-3-7-16(14)12-15/h10-13,17-18H,2-9H2,1H3 |
| InChIKey | DQSSJSFRIZHPNP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|