About N-cyclopentyloxy-1-(1,3-oxazol-5-yl)methanamine
N-cyclopentyloxy-1-(1,3-oxazol-5-yl)methanamine (PubChem CID 83228855) has the molecular formula C9H14N2O2
and a molecular weight of 182.22 g/mol. Its IUPAC name is N-cyclopentyloxy-1-(1,3-oxazol-5-yl)methanamine.
Molecular Properties
| Compound Name | N-cyclopentyloxy-1-(1,3-oxazol-5-yl)methanamine |
| PubChem CID | 83228855 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | N-cyclopentyloxy-1-(1,3-oxazol-5-yl)methanamine |
| SMILES | c1ncc(CNOC2CCCC2)o1 |
| InChI | InChI=1S/C9H14N2O2/c1-2-4-8(3-1)13-11-6-9-5-10-7-12-9/h5,7-8,11H,1-4,6H2 |
| InChIKey | KYBUZKKYSIAWBU-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopentyloxy-1-(1,3-oxazol-5-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyloxy-1-(1,3-oxazol-5-yl)methanamine?
The IUPAC name of N-cyclopentyloxy-1-(1,3-oxazol-5-yl)methanamine (CID 83228855) is N-cyclopentyloxy-1-(1,3-oxazol-5-yl)methanamine.
What is the SMILES notation for N-cyclopentyloxy-1-(1,3-oxazol-5-yl)methanamine?
The canonical SMILES for N-cyclopentyloxy-1-(1,3-oxazol-5-yl)methanamine is c1ncc(CNOC2CCCC2)o1.
What is the InChIKey of N-cyclopentyloxy-1-(1,3-oxazol-5-yl)methanamine?
The InChIKey is KYBUZKKYSIAWBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2/c1-2-4-8(3-1)13-11-6-9-5-10-7-12-9/h5,7-8,11H,1-4,6H2.
What are the key properties of N-cyclopentyloxy-1-(1,3-oxazol-5-yl)methanamine?
N-cyclopentyloxy-1-(1,3-oxazol-5-yl)methanamine has a molecular weight of 182.22 g/mol, XLogP of 1.64, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyloxy-1-(1,3-oxazol-5-yl)methanamine is sourced from PubChem (CID 83228855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).