About N-cyclopentyloxy-1-(2,4,6-trimethyl-3-pyridinyl)ethanamine
N-cyclopentyloxy-1-(2,4,6-trimethyl-3-pyridinyl)ethanamine (PubChem CID 83229480) has the molecular formula C15H24N2O
and a molecular weight of 248.37 g/mol. Its IUPAC name is N-cyclopentyloxy-1-(2,4,6-trimethyl-3-pyridinyl)ethanamine.
Molecular Properties
| Compound Name | N-cyclopentyloxy-1-(2,4,6-trimethyl-3-pyridinyl)ethanamine |
| PubChem CID | 83229480 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | N-cyclopentyloxy-1-(2,4,6-trimethyl-3-pyridinyl)ethanamine |
| SMILES | Cc1cc(C)c(C(C)NOC2CCCC2)c(C)n1 |
| InChI | InChI=1S/C15H24N2O/c1-10-9-11(2)16-12(3)15(10)13(4)17-18-14-7-5-6-8-14/h9,13-14,17H,5-8H2,1-4H3 |
| InChIKey | HHXUZBVHOCWOHV-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopentyloxy-1-(2,4,6-trimethyl-3-pyridinyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyloxy-1-(2,4,6-trimethyl-3-pyridinyl)ethanamine?
The IUPAC name of N-cyclopentyloxy-1-(2,4,6-trimethyl-3-pyridinyl)ethanamine (CID 83229480) is N-cyclopentyloxy-1-(2,4,6-trimethyl-3-pyridinyl)ethanamine.
What is the SMILES notation for N-cyclopentyloxy-1-(2,4,6-trimethyl-3-pyridinyl)ethanamine?
The canonical SMILES for N-cyclopentyloxy-1-(2,4,6-trimethyl-3-pyridinyl)ethanamine is Cc1cc(C)c(C(C)NOC2CCCC2)c(C)n1.
What is the InChIKey of N-cyclopentyloxy-1-(2,4,6-trimethyl-3-pyridinyl)ethanamine?
The InChIKey is HHXUZBVHOCWOHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O/c1-10-9-11(2)16-12(3)15(10)13(4)17-18-14-7-5-6-8-14/h9,13-14,17H,5-8H2,1-4H3.
What are the key properties of N-cyclopentyloxy-1-(2,4,6-trimethyl-3-pyridinyl)ethanamine?
N-cyclopentyloxy-1-(2,4,6-trimethyl-3-pyridinyl)ethanamine has a molecular weight of 248.37 g/mol, XLogP of 3.53, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyloxy-1-(2,4,6-trimethyl-3-pyridinyl)ethanamine is sourced from PubChem (CID 83229480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).