C14H21BrClN3 — CID 83230304
N-[(3-bromo-4-chlorophenyl)methyl]-N-methyl-2-piperazin-1-ylethanamine (PubChem CID 83230304) has the molecular formula C14H21BrClN3 and a molecular weight of 346.70 g/mol. Its IUPAC name is N-[(3-bromo-4-chlorophenyl)methyl]-N-methyl-2-piperazin-1-ylethanamine.
| Compound Name | N-[(3-bromo-4-chlorophenyl)methyl]-N-methyl-2-piperazin-1-ylethanamine |
|---|---|
| PubChem CID | 83230304 |
| Molecular Formula | C14H21BrClN3 |
| Molecular Weight | 346.70 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | N-[(3-bromo-4-chlorophenyl)methyl]-N-methyl-2-piperazin-1-ylethanamine |
| SMILES | CN(CCN1CCNCC1)Cc1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C14H21BrClN3/c1-18(8-9-19-6-4-17-5-7-19)11-12-2-3-14(16)13(15)10-12/h2-3,10,17H,4-9,11H2,1H3 |
| InChIKey | YQCPFWCVYCHAEW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.70 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |