C11H16F3N3O2 — CID 83231692
ethyl 5-methyl-4-(5,5,5-trifluoropentyl)-1,2,4-triazole-3-carboxylate (PubChem CID 83231692) has the molecular formula C11H16F3N3O2 and a molecular weight of 279.26 g/mol. Its IUPAC name is ethyl 5-methyl-4-(5,5,5-trifluoropentyl)-1,2,4-triazole-3-carboxylate.
| Compound Name | ethyl 5-methyl-4-(5,5,5-trifluoropentyl)-1,2,4-triazole-3-carboxylate |
|---|---|
| PubChem CID | 83231692 |
| Molecular Formula | C11H16F3N3O2 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | ethyl 5-methyl-4-(5,5,5-trifluoropentyl)-1,2,4-triazole-3-carboxylate |
| SMILES | CCOC(=O)c1nnc(C)n1CCCCC(F)(F)F |
| InChI | InChI=1S/C11H16F3N3O2/c1-3-19-10(18)9-16-15-8(2)17(9)7-5-4-6-11(12,13)14/h3-7H2,1-2H3 |
| InChIKey | ITFSTBKZNSOPPH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|