About 4-methyl-2-pyrazin-2-yl-3,4-dihydropyrazol-5-amine
4-methyl-2-pyrazin-2-yl-3,4-dihydropyrazol-5-amine (PubChem CID 83231950) has the molecular formula C8H11N5
and a molecular weight of 177.21 g/mol. Its IUPAC name is 4-methyl-2-pyrazin-2-yl-3,4-dihydropyrazol-5-amine.
Molecular Properties
| Compound Name | 4-methyl-2-pyrazin-2-yl-3,4-dihydropyrazol-5-amine |
| PubChem CID | 83231950 |
| Molecular Formula | C8H11N5 |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 4-methyl-2-pyrazin-2-yl-3,4-dihydropyrazol-5-amine |
| SMILES | CC1CN(c2cnccn2)N=C1N |
| InChI | InChI=1S/C8H11N5/c1-6-5-13(12-8(6)9)7-4-10-2-3-11-7/h2-4,6H,5H2,1H3,(H2,9,12) |
| InChIKey | QQLRMHIDBAWXTD-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 67.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-methyl-2-pyrazin-2-yl-3,4-dihydropyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-pyrazin-2-yl-3,4-dihydropyrazol-5-amine?
The IUPAC name of 4-methyl-2-pyrazin-2-yl-3,4-dihydropyrazol-5-amine (CID 83231950) is 4-methyl-2-pyrazin-2-yl-3,4-dihydropyrazol-5-amine.
What is the SMILES notation for 4-methyl-2-pyrazin-2-yl-3,4-dihydropyrazol-5-amine?
The canonical SMILES for 4-methyl-2-pyrazin-2-yl-3,4-dihydropyrazol-5-amine is CC1CN(c2cnccn2)N=C1N.
What is the InChIKey of 4-methyl-2-pyrazin-2-yl-3,4-dihydropyrazol-5-amine?
The InChIKey is QQLRMHIDBAWXTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N5/c1-6-5-13(12-8(6)9)7-4-10-2-3-11-7/h2-4,6H,5H2,1H3,(H2,9,12).
What are the key properties of 4-methyl-2-pyrazin-2-yl-3,4-dihydropyrazol-5-amine?
4-methyl-2-pyrazin-2-yl-3,4-dihydropyrazol-5-amine has a molecular weight of 177.21 g/mol, XLogP of 0.20, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-pyrazin-2-yl-3,4-dihydropyrazol-5-amine is sourced from PubChem (CID 83231950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).