C9H8F3NO2S — CID 83233628
4,4,8-trifluoro-1,1-dioxo-2,3-dihydrothiochromen-3-amine (PubChem CID 83233628) has the molecular formula C9H8F3NO2S and a molecular weight of 251.23 g/mol. Its IUPAC name is 4,4,8-trifluoro-1,1-dioxo-2,3-dihydrothiochromen-3-amine.
| Compound Name | 4,4,8-trifluoro-1,1-dioxo-2,3-dihydrothiochromen-3-amine |
|---|---|
| PubChem CID | 83233628 |
| Molecular Formula | C9H8F3NO2S |
| Molecular Weight | 251.23 g/mol |
| Exact Mass | 251.02 |
| IUPAC Name | 4,4,8-trifluoro-1,1-dioxo-2,3-dihydrothiochromen-3-amine |
| SMILES | NC1CS(=O)(=O)c2c(F)cccc2C1(F)F |
| InChI | InChI=1S/C9H8F3NO2S/c10-6-3-1-2-5-8(6)16(14,15)4-7(13)9(5,11)12/h1-3,7H,4,13H2 |
| InChIKey | BZAPEHNSXDGWCH-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.23 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |