C11H12BrFO2 — CID 83234025
6-bromo-5-fluoro-2-propyl-2,3-dihydro-1-benzofuran-3-ol (PubChem CID 83234025) has the molecular formula C11H12BrFO2 and a molecular weight of 275.12 g/mol. Its IUPAC name is 6-bromo-5-fluoro-2-propyl-2,3-dihydro-1-benzofuran-3-ol.
| Compound Name | 6-bromo-5-fluoro-2-propyl-2,3-dihydro-1-benzofuran-3-ol |
|---|---|
| PubChem CID | 83234025 |
| Molecular Formula | C11H12BrFO2 |
| Molecular Weight | 275.12 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | 6-bromo-5-fluoro-2-propyl-2,3-dihydro-1-benzofuran-3-ol |
| SMILES | CCCC1Oc2cc(Br)c(F)cc2C1O |
| InChI | InChI=1S/C11H12BrFO2/c1-2-3-9-11(14)6-4-8(13)7(12)5-10(6)15-9/h4-5,9,11,14H,2-3H2,1H3 |
| InChIKey | VZKYFOSCCXGLRY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.12 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |