C12H5BrCl2FNO3 — CID 83234613
1-(3-bromo-4-fluorophenoxy)-4,5-dichloro-2-nitrobenzene (PubChem CID 83234613) has the molecular formula C12H5BrCl2FNO3 and a molecular weight of 380.98 g/mol. Its IUPAC name is 1-(3-bromo-4-fluorophenoxy)-4,5-dichloro-2-nitrobenzene.
| Compound Name | 1-(3-bromo-4-fluorophenoxy)-4,5-dichloro-2-nitrobenzene |
|---|---|
| PubChem CID | 83234613 |
| Molecular Formula | C12H5BrCl2FNO3 |
| Molecular Weight | 380.98 g/mol |
| Exact Mass | 378.88 |
| IUPAC Name | 1-(3-bromo-4-fluorophenoxy)-4,5-dichloro-2-nitrobenzene |
| SMILES | O=[N+]([O-])c1cc(Cl)c(Cl)cc1Oc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C12H5BrCl2FNO3/c13-7-3-6(1-2-10(7)16)20-12-5-9(15)8(14)4-11(12)17(18)19/h1-5H |
| InChIKey | HZBMJWBQCQTKOF-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.98 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|