About 2-(3-chlorophenyl)-3-(1,1-dioxothiolan-3-yl)-5-methylimidazolidin-4-one
2-(3-chlorophenyl)-3-(1,1-dioxothiolan-3-yl)-5-methylimidazolidin-4-one (PubChem CID 83236881) has the molecular formula C14H17ClN2O3S
and a molecular weight of 328.82 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-3-(1,1-dioxothiolan-3-yl)-5-methylimidazolidin-4-one.
Molecular Properties
| Compound Name | 2-(3-chlorophenyl)-3-(1,1-dioxothiolan-3-yl)-5-methylimidazolidin-4-one |
| PubChem CID | 83236881 |
| Molecular Formula | C14H17ClN2O3S |
| Molecular Weight | 328.82 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 2-(3-chlorophenyl)-3-(1,1-dioxothiolan-3-yl)-5-methylimidazolidin-4-one |
| SMILES | CC1NC(c2cccc(Cl)c2)N(C2CCS(=O)(=O)C2)C1=O |
| InChI | InChI=1S/C14H17ClN2O3S/c1-9-14(18)17(12-5-6-21(19,20)8-12)13(16-9)10-3-2-4-11(15)7-10/h2-4,7,9,12-13,16H,5-6,8H2,1H3 |
| InChIKey | MQJFEDAWTGUUME-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.82 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-chlorophenyl)-3-(1,1-dioxothiolan-3-yl)-5-methylimidazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chlorophenyl)-3-(1,1-dioxothiolan-3-yl)-5-methylimidazolidin-4-one?
The IUPAC name of 2-(3-chlorophenyl)-3-(1,1-dioxothiolan-3-yl)-5-methylimidazolidin-4-one (CID 83236881) is 2-(3-chlorophenyl)-3-(1,1-dioxothiolan-3-yl)-5-methylimidazolidin-4-one.
What is the SMILES notation for 2-(3-chlorophenyl)-3-(1,1-dioxothiolan-3-yl)-5-methylimidazolidin-4-one?
The canonical SMILES for 2-(3-chlorophenyl)-3-(1,1-dioxothiolan-3-yl)-5-methylimidazolidin-4-one is CC1NC(c2cccc(Cl)c2)N(C2CCS(=O)(=O)C2)C1=O.
What is the InChIKey of 2-(3-chlorophenyl)-3-(1,1-dioxothiolan-3-yl)-5-methylimidazolidin-4-one?
The InChIKey is MQJFEDAWTGUUME-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17ClN2O3S/c1-9-14(18)17(12-5-6-21(19,20)8-12)13(16-9)10-3-2-4-11(15)7-10/h2-4,7,9,12-13,16H,5-6,8H2,1H3.
What are the key properties of 2-(3-chlorophenyl)-3-(1,1-dioxothiolan-3-yl)-5-methylimidazolidin-4-one?
2-(3-chlorophenyl)-3-(1,1-dioxothiolan-3-yl)-5-methylimidazolidin-4-one has a molecular weight of 328.82 g/mol, XLogP of 1.35, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chlorophenyl)-3-(1,1-dioxothiolan-3-yl)-5-methylimidazolidin-4-one is sourced from PubChem (CID 83236881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).