About 3-[3-(dimethylamino)-2,2-dimethylpropyl]-5-ethyl-2-(2-methylpropyl)imidazolidin-4-one
3-[3-(dimethylamino)-2,2-dimethylpropyl]-5-ethyl-2-(2-methylpropyl)imidazolidin-4-one (PubChem CID 83236927) has the molecular formula C16H33N3O
and a molecular weight of 283.46 g/mol. Its IUPAC name is 3-[3-(dimethylamino)-2,2-dimethylpropyl]-5-ethyl-2-(2-methylpropyl)imidazolidin-4-one.
Molecular Properties
| Compound Name | 3-[3-(dimethylamino)-2,2-dimethylpropyl]-5-ethyl-2-(2-methylpropyl)imidazolidin-4-one |
| PubChem CID | 83236927 |
| Molecular Formula | C16H33N3O |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.26 |
| IUPAC Name | 3-[3-(dimethylamino)-2,2-dimethylpropyl]-5-ethyl-2-(2-methylpropyl)imidazolidin-4-one |
| SMILES | CCC1NC(CC(C)C)N(CC(C)(C)CN(C)C)C1=O |
| InChI | InChI=1S/C16H33N3O/c1-8-13-15(20)19(14(17-13)9-12(2)3)11-16(4,5)10-18(6)7/h12-14,17H,8-11H2,1-7H3 |
| InChIKey | KLOOHCUKYIWKFF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[3-(dimethylamino)-2,2-dimethylpropyl]-5-ethyl-2-(2-methylpropyl)imidazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(dimethylamino)-2,2-dimethylpropyl]-5-ethyl-2-(2-methylpropyl)imidazolidin-4-one?
The IUPAC name of 3-[3-(dimethylamino)-2,2-dimethylpropyl]-5-ethyl-2-(2-methylpropyl)imidazolidin-4-one (CID 83236927) is 3-[3-(dimethylamino)-2,2-dimethylpropyl]-5-ethyl-2-(2-methylpropyl)imidazolidin-4-one.
What is the SMILES notation for 3-[3-(dimethylamino)-2,2-dimethylpropyl]-5-ethyl-2-(2-methylpropyl)imidazolidin-4-one?
The canonical SMILES for 3-[3-(dimethylamino)-2,2-dimethylpropyl]-5-ethyl-2-(2-methylpropyl)imidazolidin-4-one is CCC1NC(CC(C)C)N(CC(C)(C)CN(C)C)C1=O.
What is the InChIKey of 3-[3-(dimethylamino)-2,2-dimethylpropyl]-5-ethyl-2-(2-methylpropyl)imidazolidin-4-one?
The InChIKey is KLOOHCUKYIWKFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33N3O/c1-8-13-15(20)19(14(17-13)9-12(2)3)11-16(4,5)10-18(6)7/h12-14,17H,8-11H2,1-7H3.
What are the key properties of 3-[3-(dimethylamino)-2,2-dimethylpropyl]-5-ethyl-2-(2-methylpropyl)imidazolidin-4-one?
3-[3-(dimethylamino)-2,2-dimethylpropyl]-5-ethyl-2-(2-methylpropyl)imidazolidin-4-one has a molecular weight of 283.46 g/mol, XLogP of 2.16, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(dimethylamino)-2,2-dimethylpropyl]-5-ethyl-2-(2-methylpropyl)imidazolidin-4-one is sourced from PubChem (CID 83236927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).