About 3-[3-(dimethylamino)-2,2-dimethylpropyl]-1,3-diazaspiro[4.4]nonan-4-one
3-[3-(dimethylamino)-2,2-dimethylpropyl]-1,3-diazaspiro[4.4]nonan-4-one (PubChem CID 83238067) has the molecular formula C14H27N3O
and a molecular weight of 253.39 g/mol. Its IUPAC name is 3-[3-(dimethylamino)-2,2-dimethylpropyl]-1,3-diazaspiro[4.4]nonan-4-one.
Molecular Properties
| Compound Name | 3-[3-(dimethylamino)-2,2-dimethylpropyl]-1,3-diazaspiro[4.4]nonan-4-one |
| PubChem CID | 83238067 |
| Molecular Formula | C14H27N3O |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.22 |
| IUPAC Name | 3-[3-(dimethylamino)-2,2-dimethylpropyl]-1,3-diazaspiro[4.4]nonan-4-one |
| SMILES | CN(C)CC(C)(C)CN1CNC2(CCCC2)C1=O |
| InChI | InChI=1S/C14H27N3O/c1-13(2,9-16(3)4)10-17-11-15-14(12(17)18)7-5-6-8-14/h15H,5-11H2,1-4H3 |
| InChIKey | CWEWCLCWFZGELE-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[3-(dimethylamino)-2,2-dimethylpropyl]-1,3-diazaspiro[4.4]nonan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(dimethylamino)-2,2-dimethylpropyl]-1,3-diazaspiro[4.4]nonan-4-one?
The IUPAC name of 3-[3-(dimethylamino)-2,2-dimethylpropyl]-1,3-diazaspiro[4.4]nonan-4-one (CID 83238067) is 3-[3-(dimethylamino)-2,2-dimethylpropyl]-1,3-diazaspiro[4.4]nonan-4-one.
What is the SMILES notation for 3-[3-(dimethylamino)-2,2-dimethylpropyl]-1,3-diazaspiro[4.4]nonan-4-one?
The canonical SMILES for 3-[3-(dimethylamino)-2,2-dimethylpropyl]-1,3-diazaspiro[4.4]nonan-4-one is CN(C)CC(C)(C)CN1CNC2(CCCC2)C1=O.
What is the InChIKey of 3-[3-(dimethylamino)-2,2-dimethylpropyl]-1,3-diazaspiro[4.4]nonan-4-one?
The InChIKey is CWEWCLCWFZGELE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27N3O/c1-13(2,9-16(3)4)10-17-11-15-14(12(17)18)7-5-6-8-14/h15H,5-11H2,1-4H3.
What are the key properties of 3-[3-(dimethylamino)-2,2-dimethylpropyl]-1,3-diazaspiro[4.4]nonan-4-one?
3-[3-(dimethylamino)-2,2-dimethylpropyl]-1,3-diazaspiro[4.4]nonan-4-one has a molecular weight of 253.39 g/mol, XLogP of 1.28, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(dimethylamino)-2,2-dimethylpropyl]-1,3-diazaspiro[4.4]nonan-4-one is sourced from PubChem (CID 83238067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).