About 6-butyl-5-methyl-4,6-diazaspiro[2.4]heptan-7-one
6-butyl-5-methyl-4,6-diazaspiro[2.4]heptan-7-one (PubChem CID 83238133) has the molecular formula C10H18N2O
and a molecular weight of 182.27 g/mol. Its IUPAC name is 6-butyl-5-methyl-4,6-diazaspiro[2.4]heptan-7-one.
Molecular Properties
| Compound Name | 6-butyl-5-methyl-4,6-diazaspiro[2.4]heptan-7-one |
| PubChem CID | 83238133 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 6-butyl-5-methyl-4,6-diazaspiro[2.4]heptan-7-one |
| SMILES | CCCCN1C(=O)C2(CC2)NC1C |
| InChI | InChI=1S/C10H18N2O/c1-3-4-7-12-8(2)11-10(5-6-10)9(12)13/h8,11H,3-7H2,1-2H3 |
| InChIKey | ROZCTDPEMUFDND-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-butyl-5-methyl-4,6-diazaspiro[2.4]heptan-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butyl-5-methyl-4,6-diazaspiro[2.4]heptan-7-one?
The IUPAC name of 6-butyl-5-methyl-4,6-diazaspiro[2.4]heptan-7-one (CID 83238133) is 6-butyl-5-methyl-4,6-diazaspiro[2.4]heptan-7-one.
What is the SMILES notation for 6-butyl-5-methyl-4,6-diazaspiro[2.4]heptan-7-one?
The canonical SMILES for 6-butyl-5-methyl-4,6-diazaspiro[2.4]heptan-7-one is CCCCN1C(=O)C2(CC2)NC1C.
What is the InChIKey of 6-butyl-5-methyl-4,6-diazaspiro[2.4]heptan-7-one?
The InChIKey is ROZCTDPEMUFDND-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O/c1-3-4-7-12-8(2)11-10(5-6-10)9(12)13/h8,11H,3-7H2,1-2H3.
What are the key properties of 6-butyl-5-methyl-4,6-diazaspiro[2.4]heptan-7-one?
6-butyl-5-methyl-4,6-diazaspiro[2.4]heptan-7-one has a molecular weight of 182.27 g/mol, XLogP of 1.10, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butyl-5-methyl-4,6-diazaspiro[2.4]heptan-7-one is sourced from PubChem (CID 83238133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).