C14H20N2O — CID 83239063
3,5-diethyl-2-(2-methylphenyl)imidazolidin-4-one (PubChem CID 83239063) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 3,5-diethyl-2-(2-methylphenyl)imidazolidin-4-one.
| Compound Name | 3,5-diethyl-2-(2-methylphenyl)imidazolidin-4-one |
|---|---|
| PubChem CID | 83239063 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 3,5-diethyl-2-(2-methylphenyl)imidazolidin-4-one |
| SMILES | CCC1NC(c2ccccc2C)N(CC)C1=O |
| InChI | InChI=1S/C14H20N2O/c1-4-12-14(17)16(5-2)13(15-12)11-9-7-6-8-10(11)3/h6-9,12-13,15H,4-5H2,1-3H3 |
| InChIKey | FVOYZLHYBHOVEY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |