About 2-(6-chloropyridazin-3-yl)-3-methyl-3,4-dihydropyrazol-5-amine
2-(6-chloropyridazin-3-yl)-3-methyl-3,4-dihydropyrazol-5-amine (PubChem CID 83240367) has the molecular formula C8H10ClN5
and a molecular weight of 211.66 g/mol. Its IUPAC name is 2-(6-chloropyridazin-3-yl)-3-methyl-3,4-dihydropyrazol-5-amine.
Molecular Properties
| Compound Name | 2-(6-chloropyridazin-3-yl)-3-methyl-3,4-dihydropyrazol-5-amine |
| PubChem CID | 83240367 |
| Molecular Formula | C8H10ClN5 |
| Molecular Weight | 211.66 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | 2-(6-chloropyridazin-3-yl)-3-methyl-3,4-dihydropyrazol-5-amine |
| SMILES | CC1CC(N)=NN1c1ccc(Cl)nn1 |
| InChI | InChI=1S/C8H10ClN5/c1-5-4-7(10)13-14(5)8-3-2-6(9)11-12-8/h2-3,5H,4H2,1H3,(H2,10,13) |
| InChIKey | KDSDFMMVNDGMPV-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 67.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.66 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(6-chloropyridazin-3-yl)-3-methyl-3,4-dihydropyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-chloropyridazin-3-yl)-3-methyl-3,4-dihydropyrazol-5-amine?
The IUPAC name of 2-(6-chloropyridazin-3-yl)-3-methyl-3,4-dihydropyrazol-5-amine (CID 83240367) is 2-(6-chloropyridazin-3-yl)-3-methyl-3,4-dihydropyrazol-5-amine.
What is the SMILES notation for 2-(6-chloropyridazin-3-yl)-3-methyl-3,4-dihydropyrazol-5-amine?
The canonical SMILES for 2-(6-chloropyridazin-3-yl)-3-methyl-3,4-dihydropyrazol-5-amine is CC1CC(N)=NN1c1ccc(Cl)nn1.
What is the InChIKey of 2-(6-chloropyridazin-3-yl)-3-methyl-3,4-dihydropyrazol-5-amine?
The InChIKey is KDSDFMMVNDGMPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClN5/c1-5-4-7(10)13-14(5)8-3-2-6(9)11-12-8/h2-3,5H,4H2,1H3,(H2,10,13).
What are the key properties of 2-(6-chloropyridazin-3-yl)-3-methyl-3,4-dihydropyrazol-5-amine?
2-(6-chloropyridazin-3-yl)-3-methyl-3,4-dihydropyrazol-5-amine has a molecular weight of 211.66 g/mol, XLogP of 1.00, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-chloropyridazin-3-yl)-3-methyl-3,4-dihydropyrazol-5-amine is sourced from PubChem (CID 83240367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).