About 4-chloro-6-(thiadiazol-4-yl)-1,3,5-triazin-2-amine
4-chloro-6-(thiadiazol-4-yl)-1,3,5-triazin-2-amine (PubChem CID 83241012) has the molecular formula C5H3ClN6S
and a molecular weight of 214.64 g/mol. Its IUPAC name is 4-chloro-6-(thiadiazol-4-yl)-1,3,5-triazin-2-amine.
Molecular Properties
| Compound Name | 4-chloro-6-(thiadiazol-4-yl)-1,3,5-triazin-2-amine |
| PubChem CID | 83241012 |
| Molecular Formula | C5H3ClN6S |
| Molecular Weight | 214.64 g/mol |
| Exact Mass | 213.98 |
| IUPAC Name | 4-chloro-6-(thiadiazol-4-yl)-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(Cl)nc(-c2csnn2)n1 |
| InChI | InChI=1S/C5H3ClN6S/c6-4-8-3(9-5(7)10-4)2-1-13-12-11-2/h1H,(H2,7,8,9,10) |
| InChIKey | SRKZBOPRGXYWOI-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.64 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-chloro-6-(thiadiazol-4-yl)-1,3,5-triazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6-(thiadiazol-4-yl)-1,3,5-triazin-2-amine?
The IUPAC name of 4-chloro-6-(thiadiazol-4-yl)-1,3,5-triazin-2-amine (CID 83241012) is 4-chloro-6-(thiadiazol-4-yl)-1,3,5-triazin-2-amine.
What is the SMILES notation for 4-chloro-6-(thiadiazol-4-yl)-1,3,5-triazin-2-amine?
The canonical SMILES for 4-chloro-6-(thiadiazol-4-yl)-1,3,5-triazin-2-amine is Nc1nc(Cl)nc(-c2csnn2)n1.
What is the InChIKey of 4-chloro-6-(thiadiazol-4-yl)-1,3,5-triazin-2-amine?
The InChIKey is SRKZBOPRGXYWOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3ClN6S/c6-4-8-3(9-5(7)10-4)2-1-13-12-11-2/h1H,(H2,7,8,9,10).
What are the key properties of 4-chloro-6-(thiadiazol-4-yl)-1,3,5-triazin-2-amine?
4-chloro-6-(thiadiazol-4-yl)-1,3,5-triazin-2-amine has a molecular weight of 214.64 g/mol, XLogP of 0.63, 1 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6-(thiadiazol-4-yl)-1,3,5-triazin-2-amine is sourced from PubChem (CID 83241012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).