C12H13ClN4O3 — CID 83241667
4-chloro-6-(2,4,5-trimethoxyphenyl)-1,3,5-triazin-2-amine (PubChem CID 83241667) has the molecular formula C12H13ClN4O3 and a molecular weight of 296.71 g/mol. Its IUPAC name is 4-chloro-6-(2,4,5-trimethoxyphenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-6-(2,4,5-trimethoxyphenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 83241667 |
| Molecular Formula | C12H13ClN4O3 |
| Molecular Weight | 296.71 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 4-chloro-6-(2,4,5-trimethoxyphenyl)-1,3,5-triazin-2-amine |
| SMILES | COc1cc(OC)c(-c2nc(N)nc(Cl)n2)cc1OC |
| InChI | InChI=1S/C12H13ClN4O3/c1-18-7-5-9(20-3)8(19-2)4-6(7)10-15-11(13)17-12(14)16-10/h4-5H,1-3H3,(H2,14,15,16,17) |
| InChIKey | ASOZWOXPGUVZAD-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 92.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.71 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |