About 3-methyl-2-(3-methyl-1,1-dioxothiolan-3-yl)-3,4-dihydropyrazol-5-amine
3-methyl-2-(3-methyl-1,1-dioxothiolan-3-yl)-3,4-dihydropyrazol-5-amine (PubChem CID 83241815) has the molecular formula C9H17N3O2S
and a molecular weight of 231.32 g/mol. Its IUPAC name is 3-methyl-2-(3-methyl-1,1-dioxothiolan-3-yl)-3,4-dihydropyrazol-5-amine.
Molecular Properties
| Compound Name | 3-methyl-2-(3-methyl-1,1-dioxothiolan-3-yl)-3,4-dihydropyrazol-5-amine |
| PubChem CID | 83241815 |
| Molecular Formula | C9H17N3O2S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 3-methyl-2-(3-methyl-1,1-dioxothiolan-3-yl)-3,4-dihydropyrazol-5-amine |
| SMILES | CC1CC(N)=NN1C1(C)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H17N3O2S/c1-7-5-8(10)11-12(7)9(2)3-4-15(13,14)6-9/h7H,3-6H2,1-2H3,(H2,10,11) |
| InChIKey | ZZOBBFYBHFQGJZ-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-methyl-2-(3-methyl-1,1-dioxothiolan-3-yl)-3,4-dihydropyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-(3-methyl-1,1-dioxothiolan-3-yl)-3,4-dihydropyrazol-5-amine?
The IUPAC name of 3-methyl-2-(3-methyl-1,1-dioxothiolan-3-yl)-3,4-dihydropyrazol-5-amine (CID 83241815) is 3-methyl-2-(3-methyl-1,1-dioxothiolan-3-yl)-3,4-dihydropyrazol-5-amine.
What is the SMILES notation for 3-methyl-2-(3-methyl-1,1-dioxothiolan-3-yl)-3,4-dihydropyrazol-5-amine?
The canonical SMILES for 3-methyl-2-(3-methyl-1,1-dioxothiolan-3-yl)-3,4-dihydropyrazol-5-amine is CC1CC(N)=NN1C1(C)CCS(=O)(=O)C1.
What is the InChIKey of 3-methyl-2-(3-methyl-1,1-dioxothiolan-3-yl)-3,4-dihydropyrazol-5-amine?
The InChIKey is ZZOBBFYBHFQGJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O2S/c1-7-5-8(10)11-12(7)9(2)3-4-15(13,14)6-9/h7H,3-6H2,1-2H3,(H2,10,11).
What are the key properties of 3-methyl-2-(3-methyl-1,1-dioxothiolan-3-yl)-3,4-dihydropyrazol-5-amine?
3-methyl-2-(3-methyl-1,1-dioxothiolan-3-yl)-3,4-dihydropyrazol-5-amine has a molecular weight of 231.32 g/mol, XLogP of -0.07, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-(3-methyl-1,1-dioxothiolan-3-yl)-3,4-dihydropyrazol-5-amine is sourced from PubChem (CID 83241815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).