About N-(4-bromophenyl)-2-(3,4-dimethylanilino)acetamide
N-(4-bromophenyl)-2-(3,4-dimethylanilino)acetamide (PubChem CID 832423) has the molecular formula C16H17BrN2O
and a molecular weight of 333.23 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-(3,4-dimethylanilino)acetamide.
Molecular Properties
| Compound Name | N-(4-bromophenyl)-2-(3,4-dimethylanilino)acetamide |
| PubChem CID | 832423 |
| Molecular Formula | C16H17BrN2O |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | N-(4-bromophenyl)-2-(3,4-dimethylanilino)acetamide |
| SMILES | Cc1ccc(NCC(=O)Nc2ccc(Br)cc2)cc1C |
| InChI | InChI=1S/C16H17BrN2O/c1-11-3-6-15(9-12(11)2)18-10-16(20)19-14-7-4-13(17)5-8-14/h3-9,18H,10H2,1-2H3,(H,19,20) |
| InChIKey | UAOVCYVNLQVWMP-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(4-bromophenyl)-2-(3,4-dimethylanilino)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-bromophenyl)-2-(3,4-dimethylanilino)acetamide?
The IUPAC name of N-(4-bromophenyl)-2-(3,4-dimethylanilino)acetamide (CID 832423) is N-(4-bromophenyl)-2-(3,4-dimethylanilino)acetamide.
What is the SMILES notation for N-(4-bromophenyl)-2-(3,4-dimethylanilino)acetamide?
The canonical SMILES for N-(4-bromophenyl)-2-(3,4-dimethylanilino)acetamide is Cc1ccc(NCC(=O)Nc2ccc(Br)cc2)cc1C.
What is the InChIKey of N-(4-bromophenyl)-2-(3,4-dimethylanilino)acetamide?
The InChIKey is UAOVCYVNLQVWMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17BrN2O/c1-11-3-6-15(9-12(11)2)18-10-16(20)19-14-7-4-13(17)5-8-14/h3-9,18H,10H2,1-2H3,(H,19,20).
What are the key properties of N-(4-bromophenyl)-2-(3,4-dimethylanilino)acetamide?
N-(4-bromophenyl)-2-(3,4-dimethylanilino)acetamide has a molecular weight of 333.23 g/mol, XLogP of 4.12, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-bromophenyl)-2-(3,4-dimethylanilino)acetamide is sourced from PubChem (CID 832423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).