About 3-(1,1-dioxothian-4-yl)-2-thiophen-2-ylimidazolidin-4-one
3-(1,1-dioxothian-4-yl)-2-thiophen-2-ylimidazolidin-4-one (PubChem CID 83244118) has the molecular formula C12H16N2O3S2
and a molecular weight of 300.40 g/mol. Its IUPAC name is 3-(1,1-dioxothian-4-yl)-2-thiophen-2-ylimidazolidin-4-one.
Molecular Properties
| Compound Name | 3-(1,1-dioxothian-4-yl)-2-thiophen-2-ylimidazolidin-4-one |
| PubChem CID | 83244118 |
| Molecular Formula | C12H16N2O3S2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 3-(1,1-dioxothian-4-yl)-2-thiophen-2-ylimidazolidin-4-one |
| SMILES | O=C1CNC(c2cccs2)N1C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H16N2O3S2/c15-11-8-13-12(10-2-1-5-18-10)14(11)9-3-6-19(16,17)7-4-9/h1-2,5,9,12-13H,3-4,6-8H2 |
| InChIKey | GTUQEVFBKFGEPL-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(1,1-dioxothian-4-yl)-2-thiophen-2-ylimidazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,1-dioxothian-4-yl)-2-thiophen-2-ylimidazolidin-4-one?
The IUPAC name of 3-(1,1-dioxothian-4-yl)-2-thiophen-2-ylimidazolidin-4-one (CID 83244118) is 3-(1,1-dioxothian-4-yl)-2-thiophen-2-ylimidazolidin-4-one.
What is the SMILES notation for 3-(1,1-dioxothian-4-yl)-2-thiophen-2-ylimidazolidin-4-one?
The canonical SMILES for 3-(1,1-dioxothian-4-yl)-2-thiophen-2-ylimidazolidin-4-one is O=C1CNC(c2cccs2)N1C1CCS(=O)(=O)CC1.
What is the InChIKey of 3-(1,1-dioxothian-4-yl)-2-thiophen-2-ylimidazolidin-4-one?
The InChIKey is GTUQEVFBKFGEPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O3S2/c15-11-8-13-12(10-2-1-5-18-10)14(11)9-3-6-19(16,17)7-4-9/h1-2,5,9,12-13H,3-4,6-8H2.
What are the key properties of 3-(1,1-dioxothian-4-yl)-2-thiophen-2-ylimidazolidin-4-one?
3-(1,1-dioxothian-4-yl)-2-thiophen-2-ylimidazolidin-4-one has a molecular weight of 300.40 g/mol, XLogP of 0.76, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,1-dioxothian-4-yl)-2-thiophen-2-ylimidazolidin-4-one is sourced from PubChem (CID 83244118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).