C17H23ClN2O — CID 83245217
2-(3-chlorophenyl)-3-(2,3-dimethylcyclohexyl)imidazolidin-4-one (PubChem CID 83245217) has the molecular formula C17H23ClN2O and a molecular weight of 306.84 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-3-(2,3-dimethylcyclohexyl)imidazolidin-4-one.
| Compound Name | 2-(3-chlorophenyl)-3-(2,3-dimethylcyclohexyl)imidazolidin-4-one |
|---|---|
| PubChem CID | 83245217 |
| Molecular Formula | C17H23ClN2O |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 2-(3-chlorophenyl)-3-(2,3-dimethylcyclohexyl)imidazolidin-4-one |
| SMILES | CC1CCCC(N2C(=O)CNC2c2cccc(Cl)c2)C1C |
| InChI | InChI=1S/C17H23ClN2O/c1-11-5-3-8-15(12(11)2)20-16(21)10-19-17(20)13-6-4-7-14(18)9-13/h4,6-7,9,11-12,15,17,19H,3,5,8,10H2,1-2H3 |
| InChIKey | MROLNKNVLRXHJA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |