C16H20F2N2O — CID 83246038
3-(2-cyclopentylethyl)-2-(2,4-difluorophenyl)imidazolidin-4-one (PubChem CID 83246038) has the molecular formula C16H20F2N2O and a molecular weight of 294.34 g/mol. Its IUPAC name is 3-(2-cyclopentylethyl)-2-(2,4-difluorophenyl)imidazolidin-4-one.
| Compound Name | 3-(2-cyclopentylethyl)-2-(2,4-difluorophenyl)imidazolidin-4-one |
|---|---|
| PubChem CID | 83246038 |
| Molecular Formula | C16H20F2N2O |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 3-(2-cyclopentylethyl)-2-(2,4-difluorophenyl)imidazolidin-4-one |
| SMILES | O=C1CNC(c2ccc(F)cc2F)N1CCC1CCCC1 |
| InChI | InChI=1S/C16H20F2N2O/c17-12-5-6-13(14(18)9-12)16-19-10-15(21)20(16)8-7-11-3-1-2-4-11/h5-6,9,11,16,19H,1-4,7-8,10H2 |
| InChIKey | QVJHYULMJXFQNY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |