C13H17FN2O4S — CID 83246302
2-(3-fluoro-4-methoxyphenyl)-3-(2-methylsulfonylethyl)imidazolidin-4-one (PubChem CID 83246302) has the molecular formula C13H17FN2O4S and a molecular weight of 316.35 g/mol. Its IUPAC name is 2-(3-fluoro-4-methoxyphenyl)-3-(2-methylsulfonylethyl)imidazolidin-4-one.
| Compound Name | 2-(3-fluoro-4-methoxyphenyl)-3-(2-methylsulfonylethyl)imidazolidin-4-one |
|---|---|
| PubChem CID | 83246302 |
| Molecular Formula | C13H17FN2O4S |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 2-(3-fluoro-4-methoxyphenyl)-3-(2-methylsulfonylethyl)imidazolidin-4-one |
| SMILES | COc1ccc(C2NCC(=O)N2CCS(C)(=O)=O)cc1F |
| InChI | InChI=1S/C13H17FN2O4S/c1-20-11-4-3-9(7-10(11)14)13-15-8-12(17)16(13)5-6-21(2,18)19/h3-4,7,13,15H,5-6,8H2,1-2H3 |
| InChIKey | NUYNLABTQSNQFI-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |