C16H22ClN3O — CID 83248992
2-(4-chlorophenyl)-3-[2-[cyclopropyl(methyl)amino]ethyl]-5-methylimidazolidin-4-one (PubChem CID 83248992) has the molecular formula C16H22ClN3O and a molecular weight of 307.82 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-[2-[cyclopropyl(methyl)amino]ethyl]-5-methylimidazolidin-4-one.
| Compound Name | 2-(4-chlorophenyl)-3-[2-[cyclopropyl(methyl)amino]ethyl]-5-methylimidazolidin-4-one |
|---|---|
| PubChem CID | 83248992 |
| Molecular Formula | C16H22ClN3O |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 2-(4-chlorophenyl)-3-[2-[cyclopropyl(methyl)amino]ethyl]-5-methylimidazolidin-4-one |
| SMILES | CC1NC(c2ccc(Cl)cc2)N(CCN(C)C2CC2)C1=O |
| InChI | InChI=1S/C16H22ClN3O/c1-11-16(21)20(10-9-19(2)14-7-8-14)15(18-11)12-3-5-13(17)6-4-12/h3-6,11,14-15,18H,7-10H2,1-2H3 |
| InChIKey | RCKSEYAYUFWZFU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |