C15H18F2N2O — CID 83254392
3-cyclobutyl-2-(3,4-difluorophenyl)-5-ethylimidazolidin-4-one (PubChem CID 83254392) has the molecular formula C15H18F2N2O and a molecular weight of 280.32 g/mol. Its IUPAC name is 3-cyclobutyl-2-(3,4-difluorophenyl)-5-ethylimidazolidin-4-one.
| Compound Name | 3-cyclobutyl-2-(3,4-difluorophenyl)-5-ethylimidazolidin-4-one |
|---|---|
| PubChem CID | 83254392 |
| Molecular Formula | C15H18F2N2O |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 3-cyclobutyl-2-(3,4-difluorophenyl)-5-ethylimidazolidin-4-one |
| SMILES | CCC1NC(c2ccc(F)c(F)c2)N(C2CCC2)C1=O |
| InChI | InChI=1S/C15H18F2N2O/c1-2-13-15(20)19(10-4-3-5-10)14(18-13)9-6-7-11(16)12(17)8-9/h6-8,10,13-14,18H,2-5H2,1H3 |
| InChIKey | HIXYWUQBZRGRJM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |