C17H34N2O — CID 83254863
3-(4-methylpentyl)-2,5-bis(2-methylpropyl)imidazolidin-4-one (PubChem CID 83254863) has the molecular formula C17H34N2O and a molecular weight of 282.47 g/mol. Its IUPAC name is 3-(4-methylpentyl)-2,5-bis(2-methylpropyl)imidazolidin-4-one.
| Compound Name | 3-(4-methylpentyl)-2,5-bis(2-methylpropyl)imidazolidin-4-one |
|---|---|
| PubChem CID | 83254863 |
| Molecular Formula | C17H34N2O |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | 3-(4-methylpentyl)-2,5-bis(2-methylpropyl)imidazolidin-4-one |
| SMILES | CC(C)CCCN1C(=O)C(CC(C)C)NC1CC(C)C |
| InChI | InChI=1S/C17H34N2O/c1-12(2)8-7-9-19-16(11-14(5)6)18-15(17(19)20)10-13(3)4/h12-16,18H,7-11H2,1-6H3 |
| InChIKey | HUHFZDSNCJHVON-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |