C10H17F3N2O — CID 83255355
5-butyl-3-(3,3,3-trifluoropropyl)imidazolidin-4-one (PubChem CID 83255355) has the molecular formula C10H17F3N2O and a molecular weight of 238.25 g/mol. Its IUPAC name is 5-butyl-3-(3,3,3-trifluoropropyl)imidazolidin-4-one.
| Compound Name | 5-butyl-3-(3,3,3-trifluoropropyl)imidazolidin-4-one |
|---|---|
| PubChem CID | 83255355 |
| Molecular Formula | C10H17F3N2O |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 5-butyl-3-(3,3,3-trifluoropropyl)imidazolidin-4-one |
| SMILES | CCCCC1NCN(CCC(F)(F)F)C1=O |
| InChI | InChI=1S/C10H17F3N2O/c1-2-3-4-8-9(16)15(7-14-8)6-5-10(11,12)13/h8,14H,2-7H2,1H3 |
| InChIKey | WGHYRRNTUUGAGL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |