C11H22N2O3S — CID 83255731
5-methyl-2-(2-methylpropyl)-3-(2-methylsulfonylethyl)imidazolidin-4-one (PubChem CID 83255731) has the molecular formula C11H22N2O3S and a molecular weight of 262.37 g/mol. Its IUPAC name is 5-methyl-2-(2-methylpropyl)-3-(2-methylsulfonylethyl)imidazolidin-4-one.
| Compound Name | 5-methyl-2-(2-methylpropyl)-3-(2-methylsulfonylethyl)imidazolidin-4-one |
|---|---|
| PubChem CID | 83255731 |
| Molecular Formula | C11H22N2O3S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 5-methyl-2-(2-methylpropyl)-3-(2-methylsulfonylethyl)imidazolidin-4-one |
| SMILES | CC(C)CC1NC(C)C(=O)N1CCS(C)(=O)=O |
| InChI | InChI=1S/C11H22N2O3S/c1-8(2)7-10-12-9(3)11(14)13(10)5-6-17(4,15)16/h8-10,12H,5-7H2,1-4H3 |
| InChIKey | JZJFBHPWEDRNIE-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |