About 2-methyl-N,N'-diphenylpropanediamide
2-methyl-N,N'-diphenylpropanediamide (PubChem CID 832561) has the molecular formula C16H16N2O2
and a molecular weight of 268.32 g/mol. Its IUPAC name is 2-methyl-N,N'-diphenylpropanediamide.
Molecular Properties
| Compound Name | 2-methyl-N,N'-diphenylpropanediamide |
| PubChem CID | 832561 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 2-methyl-N,N'-diphenylpropanediamide |
| SMILES | CC(C(=O)Nc1ccccc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C16H16N2O2/c1-12(15(19)17-13-8-4-2-5-9-13)16(20)18-14-10-6-3-7-11-14/h2-12H,1H3,(H,17,19)(H,18,20) |
| InChIKey | YFMSXISDQGLRJM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N,N'-diphenylpropanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N,N'-diphenylpropanediamide?
The IUPAC name of 2-methyl-N,N'-diphenylpropanediamide (CID 832561) is 2-methyl-N,N'-diphenylpropanediamide.
What is the SMILES notation for 2-methyl-N,N'-diphenylpropanediamide?
The canonical SMILES for 2-methyl-N,N'-diphenylpropanediamide is CC(C(=O)Nc1ccccc1)C(=O)Nc1ccccc1.
What is the InChIKey of 2-methyl-N,N'-diphenylpropanediamide?
The InChIKey is YFMSXISDQGLRJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O2/c1-12(15(19)17-13-8-4-2-5-9-13)16(20)18-14-10-6-3-7-11-14/h2-12H,1H3,(H,17,19)(H,18,20).
What are the key properties of 2-methyl-N,N'-diphenylpropanediamide?
2-methyl-N,N'-diphenylpropanediamide has a molecular weight of 268.32 g/mol, XLogP of 2.90, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N,N'-diphenylpropanediamide is sourced from PubChem (CID 832561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).