C12H24N2O3S — CID 83256448
5-ethyl-5-methyl-3-(2-methylsulfonylethyl)-2-propylimidazolidin-4-one (PubChem CID 83256448) has the molecular formula C12H24N2O3S and a molecular weight of 276.40 g/mol. Its IUPAC name is 5-ethyl-5-methyl-3-(2-methylsulfonylethyl)-2-propylimidazolidin-4-one.
| Compound Name | 5-ethyl-5-methyl-3-(2-methylsulfonylethyl)-2-propylimidazolidin-4-one |
|---|---|
| PubChem CID | 83256448 |
| Molecular Formula | C12H24N2O3S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 5-ethyl-5-methyl-3-(2-methylsulfonylethyl)-2-propylimidazolidin-4-one |
| SMILES | CCCC1NC(C)(CC)C(=O)N1CCS(C)(=O)=O |
| InChI | InChI=1S/C12H24N2O3S/c1-5-7-10-13-12(3,6-2)11(15)14(10)8-9-18(4,16)17/h10,13H,5-9H2,1-4H3 |
| InChIKey | CNCACTIDRGBIER-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |