C15H24N2OS2 — CID 83257048
3-(2-methyl-3-methylsulfanylpropyl)-5-propyl-2-thiophen-3-ylimidazolidin-4-one (PubChem CID 83257048) has the molecular formula C15H24N2OS2 and a molecular weight of 312.50 g/mol. Its IUPAC name is 3-(2-methyl-3-methylsulfanylpropyl)-5-propyl-2-thiophen-3-ylimidazolidin-4-one.
| Compound Name | 3-(2-methyl-3-methylsulfanylpropyl)-5-propyl-2-thiophen-3-ylimidazolidin-4-one |
|---|---|
| PubChem CID | 83257048 |
| Molecular Formula | C15H24N2OS2 |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 3-(2-methyl-3-methylsulfanylpropyl)-5-propyl-2-thiophen-3-ylimidazolidin-4-one |
| SMILES | CCCC1NC(c2ccsc2)N(CC(C)CSC)C1=O |
| InChI | InChI=1S/C15H24N2OS2/c1-4-5-13-15(18)17(8-11(2)9-19-3)14(16-13)12-6-7-20-10-12/h6-7,10-11,13-14,16H,4-5,8-9H2,1-3H3 |
| InChIKey | YVJUEXAPECXYJQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |