C16H21FN2O — CID 83258448
3-(2-cyclopropylethyl)-5-ethyl-2-(4-fluorophenyl)imidazolidin-4-one (PubChem CID 83258448) has the molecular formula C16H21FN2O and a molecular weight of 276.36 g/mol. Its IUPAC name is 3-(2-cyclopropylethyl)-5-ethyl-2-(4-fluorophenyl)imidazolidin-4-one.
| Compound Name | 3-(2-cyclopropylethyl)-5-ethyl-2-(4-fluorophenyl)imidazolidin-4-one |
|---|---|
| PubChem CID | 83258448 |
| Molecular Formula | C16H21FN2O |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 3-(2-cyclopropylethyl)-5-ethyl-2-(4-fluorophenyl)imidazolidin-4-one |
| SMILES | CCC1NC(c2ccc(F)cc2)N(CCC2CC2)C1=O |
| InChI | InChI=1S/C16H21FN2O/c1-2-14-16(20)19(10-9-11-3-4-11)15(18-14)12-5-7-13(17)8-6-12/h5-8,11,14-15,18H,2-4,9-10H2,1H3 |
| InChIKey | PHFLANAKDSCFQT-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |