C14H28N2O3S — CID 83258702
5-butyl-2-ethyl-3-(2-methyl-2-methylsulfonylpropyl)imidazolidin-4-one (PubChem CID 83258702) has the molecular formula C14H28N2O3S and a molecular weight of 304.46 g/mol. Its IUPAC name is 5-butyl-2-ethyl-3-(2-methyl-2-methylsulfonylpropyl)imidazolidin-4-one.
| Compound Name | 5-butyl-2-ethyl-3-(2-methyl-2-methylsulfonylpropyl)imidazolidin-4-one |
|---|---|
| PubChem CID | 83258702 |
| Molecular Formula | C14H28N2O3S |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 5-butyl-2-ethyl-3-(2-methyl-2-methylsulfonylpropyl)imidazolidin-4-one |
| SMILES | CCCCC1NC(CC)N(CC(C)(C)S(C)(=O)=O)C1=O |
| InChI | InChI=1S/C14H28N2O3S/c1-6-8-9-11-13(17)16(12(7-2)15-11)10-14(3,4)20(5,18)19/h11-12,15H,6-10H2,1-5H3 |
| InChIKey | JATXOFATORQIAZ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |