C13H21F3N2O — CID 83260127
5-propyl-6-(5,5,5-trifluoropentyl)-4,6-diazaspiro[2.4]heptan-7-one (PubChem CID 83260127) has the molecular formula C13H21F3N2O and a molecular weight of 278.32 g/mol. Its IUPAC name is 5-propyl-6-(5,5,5-trifluoropentyl)-4,6-diazaspiro[2.4]heptan-7-one.
| Compound Name | 5-propyl-6-(5,5,5-trifluoropentyl)-4,6-diazaspiro[2.4]heptan-7-one |
|---|---|
| PubChem CID | 83260127 |
| Molecular Formula | C13H21F3N2O |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 5-propyl-6-(5,5,5-trifluoropentyl)-4,6-diazaspiro[2.4]heptan-7-one |
| SMILES | CCCC1NC2(CC2)C(=O)N1CCCCC(F)(F)F |
| InChI | InChI=1S/C13H21F3N2O/c1-2-5-10-17-12(7-8-12)11(19)18(10)9-4-3-6-13(14,15)16/h10,17H,2-9H2,1H3 |
| InChIKey | TTYYMVZXSCUPMC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|