C13H21F3N2O — CID 83260209
5-propan-2-yl-6-(5,5,5-trifluoropentyl)-4,6-diazaspiro[2.4]heptan-7-one (PubChem CID 83260209) has the molecular formula C13H21F3N2O and a molecular weight of 278.32 g/mol. Its IUPAC name is 5-propan-2-yl-6-(5,5,5-trifluoropentyl)-4,6-diazaspiro[2.4]heptan-7-one.
| Compound Name | 5-propan-2-yl-6-(5,5,5-trifluoropentyl)-4,6-diazaspiro[2.4]heptan-7-one |
|---|---|
| PubChem CID | 83260209 |
| Molecular Formula | C13H21F3N2O |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 5-propan-2-yl-6-(5,5,5-trifluoropentyl)-4,6-diazaspiro[2.4]heptan-7-one |
| SMILES | CC(C)C1NC2(CC2)C(=O)N1CCCCC(F)(F)F |
| InChI | InChI=1S/C13H21F3N2O/c1-9(2)10-17-12(6-7-12)11(19)18(10)8-4-3-5-13(14,15)16/h9-10,17H,3-8H2,1-2H3 |
| InChIKey | OMMMECSCGMDHFO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|