About 2-cyclopentyl-3-(2,2-dimethyloxan-4-yl)-5-methylimidazolidin-4-one
2-cyclopentyl-3-(2,2-dimethyloxan-4-yl)-5-methylimidazolidin-4-one (PubChem CID 83260627) has the molecular formula C16H28N2O2
and a molecular weight of 280.41 g/mol. Its IUPAC name is 2-cyclopentyl-3-(2,2-dimethyloxan-4-yl)-5-methylimidazolidin-4-one.
Molecular Properties
| Compound Name | 2-cyclopentyl-3-(2,2-dimethyloxan-4-yl)-5-methylimidazolidin-4-one |
| PubChem CID | 83260627 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 2-cyclopentyl-3-(2,2-dimethyloxan-4-yl)-5-methylimidazolidin-4-one |
| SMILES | CC1NC(C2CCCC2)N(C2CCOC(C)(C)C2)C1=O |
| InChI | InChI=1S/C16H28N2O2/c1-11-15(19)18(13-8-9-20-16(2,3)10-13)14(17-11)12-6-4-5-7-12/h11-14,17H,4-10H2,1-3H3 |
| InChIKey | BOJLKYALVHYDRB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclopentyl-3-(2,2-dimethyloxan-4-yl)-5-methylimidazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentyl-3-(2,2-dimethyloxan-4-yl)-5-methylimidazolidin-4-one?
The IUPAC name of 2-cyclopentyl-3-(2,2-dimethyloxan-4-yl)-5-methylimidazolidin-4-one (CID 83260627) is 2-cyclopentyl-3-(2,2-dimethyloxan-4-yl)-5-methylimidazolidin-4-one.
What is the SMILES notation for 2-cyclopentyl-3-(2,2-dimethyloxan-4-yl)-5-methylimidazolidin-4-one?
The canonical SMILES for 2-cyclopentyl-3-(2,2-dimethyloxan-4-yl)-5-methylimidazolidin-4-one is CC1NC(C2CCCC2)N(C2CCOC(C)(C)C2)C1=O.
What is the InChIKey of 2-cyclopentyl-3-(2,2-dimethyloxan-4-yl)-5-methylimidazolidin-4-one?
The InChIKey is BOJLKYALVHYDRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N2O2/c1-11-15(19)18(13-8-9-20-16(2,3)10-13)14(17-11)12-6-4-5-7-12/h11-14,17H,4-10H2,1-3H3.
What are the key properties of 2-cyclopentyl-3-(2,2-dimethyloxan-4-yl)-5-methylimidazolidin-4-one?
2-cyclopentyl-3-(2,2-dimethyloxan-4-yl)-5-methylimidazolidin-4-one has a molecular weight of 280.41 g/mol, XLogP of 2.28, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentyl-3-(2,2-dimethyloxan-4-yl)-5-methylimidazolidin-4-one is sourced from PubChem (CID 83260627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).